C34H36ClN3O4 — CID 161496347
N-benzyl-4-phenylbutan-1-amine;3-[5-chloro-6-[(1R)-1-pyridin-2-ylethoxy]-1,2-benzoxazol-3-yl]propanoic acid (PubChem CID 161496347) has the molecular formula C34H36ClN3O4 and a molecular weight of 586.13 g/mol. Its IUPAC name is N-benzyl-4-phenylbutan-1-amine;3-[5-chloro-6-[(1R)-1-pyridin-2-ylethoxy]-1,2-benzoxazol-3-yl]propanoic acid.
| Compound Name | N-benzyl-4-phenylbutan-1-amine;3-[5-chloro-6-[(1R)-1-pyridin-2-ylethoxy]-1,2-benzoxazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 161496347 |
| Molecular Formula | C34H36ClN3O4 |
| Molecular Weight | 586.13 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | N-benzyl-4-phenylbutan-1-amine;3-[5-chloro-6-[(1R)-1-pyridin-2-ylethoxy]-1,2-benzoxazol-3-yl]propanoic acid |
| SMILES | C[C@@H](Oc1cc2onc(CCC(=O)O)c2cc1Cl)c1ccccn1.c1ccc(CCCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H15ClN2O4.C17H21N/c1-10(13-4-2-3-7-19-13)23-16-9-15-11(8-12(16)18)14(20-24-15)5-6-17(21)22;1-3-9-16(10-4-1)11-7-8-14-18-15-17-12-5-2-6-13-17/h2-4,7-10H,5-6H2,1H3,(H,21,22);1-6,9-10,12-13,18H,7-8,11,14-15H2/t10-;/m1./s1 |
| InChIKey | WGGIMMIETYLOKP-HNCPQSOCSA-N |
| XLogP | 7.83 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.13 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|