C18H18ClN3O2 — CID 161499504
2-chloro-7-[(3S)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5,6-dihydro-1,7-naphthyridin-8-one (PubChem CID 161499504) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-chloro-7-[(3S)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5,6-dihydro-1,7-naphthyridin-8-one.
| Compound Name | 2-chloro-7-[(3S)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5,6-dihydro-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 161499504 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-chloro-7-[(3S)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5,6-dihydro-1,7-naphthyridin-8-one |
| SMILES | CN1C[C@H](N2CCc3ccc(Cl)nc3C2=O)COc2ccccc21 |
| InChI | InChI=1S/C18H18ClN3O2/c1-21-10-13(11-24-15-5-3-2-4-14(15)21)22-9-8-12-6-7-16(19)20-17(12)18(22)23/h2-7,13H,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | WGQNSBJEGKJSAW-ZDUSSCGKSA-N |
| XLogP | 2.63 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|