C16H22O5 — CID 162001215
[(3aS,4R,7aR)-6-acetylspiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] acetate (PubChem CID 162001215) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(3aS,4R,7aR)-6-acetylspiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] acetate.
| Compound Name | [(3aS,4R,7aR)-6-acetylspiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] acetate |
|---|---|
| PubChem CID | 162001215 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(3aS,4R,7aR)-6-acetylspiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(C(C)=O)=C[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C16H22O5/c1-10(17)12-8-13(19-11(2)18)15-14(9-12)20-16(21-15)6-4-3-5-7-16/h9,13-15H,3-8H2,1-2H3/t13-,14-,15+/m1/s1 |
| InChIKey | YSFVADDPDJANHW-KFWWJZLASA-N |
| XLogP | 2.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |