About methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium
methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium (PubChem CID 162004220) has the molecular formula C7H9N2O2SY-
and a molecular weight of 274.13 g/mol. Its IUPAC name is methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium.
Molecular Properties
| Compound Name | methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium |
| PubChem CID | 162004220 |
| Molecular Formula | C7H9N2O2SY- |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium |
| SMILES | CS.[O-]/N=C\c1cc[n+]([O-])cc1.[Y] |
| InChI | InChI=1S/C6H6N2O2.CH4S.Y/c9-7-5-6-1-3-8(10)4-2-6;1-2;/h1-5,9H;2H,1H3;/p-1/b7-5-;; |
| InChIKey | YSPMVEBXIYSNSJ-MWKZNRQPSA-M |
| XLogP | 0.78 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium?
The IUPAC name of methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium (CID 162004220) is methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium.
What is the SMILES notation for methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium?
The canonical SMILES for methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium is CS.[O-]/N=C\c1cc[n+]([O-])cc1.[Y].
What is the InChIKey of methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium?
The InChIKey is YSPMVEBXIYSNSJ-MWKZNRQPSA-M. The full InChI is InChI=1S/C6H6N2O2.CH4S.Y/c9-7-5-6-1-3-8(10)4-2-6;1-2;/h1-5,9H;2H,1H3;/p-1/b7-5-;;.
What are the key properties of methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium?
methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium has a molecular weight of 274.13 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;(E)-N-oxido-1-(1-oxidopyridin-1-ium-4-yl)methanimine;yttrium is sourced from PubChem (CID 162004220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).