C13H14CsNO — CID 100939825
cesium (Z)-1-[4-(2,2-dimethyl-3-methylidenecyclopropyl)phenyl]-N-oxidomethanimine (PubChem CID 100939825) has the molecular formula C13H14CsNO and a molecular weight of 333.17 g/mol. Its IUPAC name is cesium (Z)-1-[4-(2,2-dimethyl-3-methylidenecyclopropyl)phenyl]-N-oxidomethanimine.
| Compound Name | cesium (Z)-1-[4-(2,2-dimethyl-3-methylidenecyclopropyl)phenyl]-N-oxidomethanimine |
|---|---|
| PubChem CID | 100939825 |
| Molecular Formula | C13H14CsNO |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | cesium (Z)-1-[4-(2,2-dimethyl-3-methylidenecyclopropyl)phenyl]-N-oxidomethanimine |
| SMILES | C=C1C(c2ccc(/C=N\[O-])cc2)C1(C)C.[Cs+] |
| InChI | InChI=1S/C13H15NO.Cs/c1-9-12(13(9,2)3)11-6-4-10(5-7-11)8-14-15;/h4-8,12,15H,1H2,2-3H3;/q;+1/p-1/b14-8-; |
| InChIKey | SHKUYLPJELLPSK-ZXDBEMHSSA-M |
| XLogP | 0.29 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|