C9H22O6 — CID 162004448
2-methylbutane-1,2,4-triol;2-methylpropane-1,1,1-triol (PubChem CID 162004448) has the molecular formula C9H22O6 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-methylbutane-1,2,4-triol;2-methylpropane-1,1,1-triol.
| Compound Name | 2-methylbutane-1,2,4-triol;2-methylpropane-1,1,1-triol |
|---|---|
| PubChem CID | 162004448 |
| Molecular Formula | C9H22O6 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-methylbutane-1,2,4-triol;2-methylpropane-1,1,1-triol |
| SMILES | CC(C)C(O)(O)O.CC(O)(CO)CCO |
| InChI | InChI=1S/C5H12O3.C4H10O3/c1-5(8,4-7)2-3-6;1-3(2)4(5,6)7/h6-8H,2-4H2,1H3;3,5-7H,1-2H3 |
| InChIKey | YSQIEFOXLRWBKK-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|