C15H18FNO3 — CID 162010776
[(4S,4aS,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]methanol (PubChem CID 162010776) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is [(4S,4aS,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]methanol.
| Compound Name | [(4S,4aS,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]methanol |
|---|---|
| PubChem CID | 162010776 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [(4S,4aS,5R,7aS)-4-(2-fluorophenyl)-2,4-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-5-yl]methanol |
| SMILES | CC1=N[C@](C)(c2ccccc2F)[C@H]2[C@H](CO)OC[C@H]2O1 |
| InChI | InChI=1S/C15H18FNO3/c1-9-17-15(2,10-5-3-4-6-11(10)16)14-12(7-18)19-8-13(14)20-9/h3-6,12-14,18H,7-8H2,1-2H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | WWTKYLVFJFJMEO-LJISPDSOSA-N |
| XLogP | 1.87 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |