C37H46F6N4O8 — CID 162011189
tert-butyl 4-[[3-(1-formyloxycyclopropyl)oxy-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate;[1-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]cyclopropyl] formate (PubChem CID 162011189) has the molecular formula C37H46F6N4O8 and a molecular weight of 788.78 g/mol. Its IUPAC name is tert-butyl 4-[[3-(1-formyloxycyclopropyl)oxy-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate;[1-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]cyclopropyl] formate.
| Compound Name | tert-butyl 4-[[3-(1-formyloxycyclopropyl)oxy-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate;[1-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]cyclopropyl] formate |
|---|---|
| PubChem CID | 162011189 |
| Molecular Formula | C37H46F6N4O8 |
| Molecular Weight | 788.78 g/mol |
| Exact Mass | 788.32 |
| IUPAC Name | tert-butyl 4-[[3-(1-formyloxycyclopropyl)oxy-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate;[1-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]cyclopropyl] formate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cc(OC3(OC=O)CC3)cc(C(F)(F)F)c2)CC1.O=COC1(Oc2cc(CN3CCNCC3)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H27F3N2O5.C16H19F3N2O3/c1-19(2,3)31-18(28)26-8-6-25(7-9-26)13-15-10-16(21(22,23)24)12-17(11-15)30-20(4-5-20)29-14-27;17-16(18,19)13-7-12(10-21-5-3-20-4-6-21)8-14(9-13)24-15(1-2-15)23-11-22/h10-12,14H,4-9,13H2,1-3H3;7-9,11,20H,1-6,10H2 |
| InChIKey | YTMMONPUQZMOMW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.78 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|