C24H31ClO7 — CID 162012555
methyl (2R)-2-[3-(chloromethyl)phenoxy]butanoate;methyl (2R)-2-[3-(hydroxymethyl)phenoxy]butanoate (PubChem CID 162012555) has the molecular formula C24H31ClO7 and a molecular weight of 466.96 g/mol. Its IUPAC name is methyl (2R)-2-[3-(chloromethyl)phenoxy]butanoate;methyl (2R)-2-[3-(hydroxymethyl)phenoxy]butanoate.
| Compound Name | methyl (2R)-2-[3-(chloromethyl)phenoxy]butanoate;methyl (2R)-2-[3-(hydroxymethyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 162012555 |
| Molecular Formula | C24H31ClO7 |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | methyl (2R)-2-[3-(chloromethyl)phenoxy]butanoate;methyl (2R)-2-[3-(hydroxymethyl)phenoxy]butanoate |
| SMILES | CC[C@@H](Oc1cccc(CCl)c1)C(=O)OC.CC[C@@H](Oc1cccc(CO)c1)C(=O)OC |
| InChI | InChI=1S/C12H15ClO3.C12H16O4/c2*1-3-11(12(14)15-2)16-10-6-4-5-9(7-10)8-13/h4-7,11H,3,8H2,1-2H3;4-7,11,13H,3,8H2,1-2H3/t2*11-/m11/s1 |
| InChIKey | YTQZOECOMOBWIQ-BSGLVDAKSA-N |
| XLogP | 4.27 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|