C20H13N4S+ — CID 162020539
11-phenyl-3-thia-7,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene (PubChem CID 162020539) has the molecular formula C20H13N4S+ and a molecular weight of 341.42 g/mol. Its IUPAC name is 11-phenyl-3-thia-7,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene.
| Compound Name | 11-phenyl-3-thia-7,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene |
|---|---|
| PubChem CID | 162020539 |
| Molecular Formula | C20H13N4S+ |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 11-phenyl-3-thia-7,11,17-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene |
| SMILES | c1ccc(-n2c3[n+](c4sc5ccncc5c42)Cc2ncccc2-3)cc1 |
| InChI | InChI=1S/C20H13N4S/c1-2-5-13(6-3-1)24-18-15-11-21-10-8-17(15)25-20(18)23-12-16-14(19(23)24)7-4-9-22-16/h1-11H,12H2/q+1 |
| InChIKey | NUJIKWGZOMURKF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|