C21H14N3S+ — CID 158835844
3-phenyl-11-thia-3,17-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene (PubChem CID 158835844) has the molecular formula C21H14N3S+ and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-phenyl-11-thia-3,17-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene.
| Compound Name | 3-phenyl-11-thia-3,17-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
|---|---|
| PubChem CID | 158835844 |
| Molecular Formula | C21H14N3S+ |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-phenyl-11-thia-3,17-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
| SMILES | c1ccc(-n2c3ccccc3c3sc4[n+](c32)Cc2ncccc2-4)cc1 |
| InChI | InChI=1S/C21H14N3S/c1-2-7-14(8-3-1)24-18-11-5-4-9-16(18)19-20(24)23-13-17-15(21(23)25-19)10-6-12-22-17/h1-12H,13H2/q+1 |
| InChIKey | AOWXKVLEWAORJM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|