C22H17N4+ — CID 160585246
3-phenyl-11-(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene (PubChem CID 160585246) has the molecular formula C22H17N4+ and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-phenyl-11-(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene.
| Compound Name | 3-phenyl-11-(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
|---|---|
| PubChem CID | 160585246 |
| Molecular Formula | C22H17N4+ |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-phenyl-11-(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
| SMILES | [2H]C([2H])([2H])n1c2[n+](c3c1c1ccccc1n3-c1ccccc1)Cc1cccnc1-2 |
| InChI | InChI=1S/C22H17N4/c1-24-20-17-11-5-6-12-18(17)26(16-9-3-2-4-10-16)22(20)25-14-15-8-7-13-23-19(15)21(24)25/h2-13H,14H2,1H3/q+1/i1D3 |
| InChIKey | GFMCDJCDLSODSE-FIBGUPNXSA-N |
| XLogP | 3.83 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|