C17H15N4+ — CID 160585245
3,11-bis(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene (PubChem CID 160585245) has the molecular formula C17H15N4+ and a molecular weight of 281.37 g/mol. Its IUPAC name is 3,11-bis(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene.
| Compound Name | 3,11-bis(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
|---|---|
| PubChem CID | 160585245 |
| Molecular Formula | C17H15N4+ |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3,11-bis(trideuteriomethyl)-3,11,14-triaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
| SMILES | [2H]C([2H])([2H])n1c2[n+](c3c1c1ccccc1n3C([2H])([2H])[2H])Cc1cccnc1-2 |
| InChI | InChI=1S/C17H15N4/c1-19-13-8-4-3-7-12(13)15-17(19)21-10-11-6-5-9-18-14(11)16(21)20(15)2/h3-9H,10H2,1-2H3/q+1/i1D3,2D3 |
| InChIKey | ANIMWGMSDSVYCI-WFGJKAKNSA-N |
| XLogP | 2.38 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|