C18H16N3+ — CID 159604546
3,11-bis(trideuteriomethyl)-3,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene (PubChem CID 159604546) has the molecular formula C18H16N3+ and a molecular weight of 280.38 g/mol. Its IUPAC name is 3,11-bis(trideuteriomethyl)-3,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene.
| Compound Name | 3,11-bis(trideuteriomethyl)-3,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
|---|---|
| PubChem CID | 159604546 |
| Molecular Formula | C18H16N3+ |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3,11-bis(trideuteriomethyl)-3,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
| SMILES | [2H]C([2H])([2H])n1c2[n+](c3c1c1ccccc1n3C([2H])([2H])[2H])Cc1ccccc1-2 |
| InChI | InChI=1S/C18H16N3/c1-19-15-10-6-5-9-14(15)16-18(19)21-11-12-7-3-4-8-13(12)17(21)20(16)2/h3-10H,11H2,1-2H3/q+1/i1D3,2D3 |
| InChIKey | OILRDANLIGOHHP-WFGJKAKNSA-N |
| XLogP | 2.99 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|