C16H14N5+ — CID 159731815
3-methyl-11-(trideuteriomethyl)-3,6,11,16-tetraza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene (PubChem CID 159731815) has the molecular formula C16H14N5+ and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-methyl-11-(trideuteriomethyl)-3,6,11,16-tetraza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene.
| Compound Name | 3-methyl-11-(trideuteriomethyl)-3,6,11,16-tetraza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene |
|---|---|
| PubChem CID | 159731815 |
| Molecular Formula | C16H14N5+ |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-methyl-11-(trideuteriomethyl)-3,6,11,16-tetraza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13(18),14,16-octaene |
| SMILES | [2H]C([2H])([2H])n1c2[n+](c3c1c1ccncc1n3C)Cc1cnccc1-2 |
| InChI | InChI=1S/C16H14N5/c1-19-13-8-18-6-4-12(13)14-16(19)21-9-10-7-17-5-3-11(10)15(21)20(14)2/h3-8H,9H2,1-2H3/q+1/i2D3 |
| InChIKey | RRTNSIUQEJEYFQ-BMSJAHLVSA-N |
| XLogP | 1.78 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|