C16H12N3S+ — CID 158353309
11-(trideuteriomethyl)-3-thia-11,16-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene (PubChem CID 158353309) has the molecular formula C16H12N3S+ and a molecular weight of 281.38 g/mol. Its IUPAC name is 11-(trideuteriomethyl)-3-thia-11,16-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene.
| Compound Name | 11-(trideuteriomethyl)-3-thia-11,16-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
|---|---|
| PubChem CID | 158353309 |
| Molecular Formula | C16H12N3S+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 11-(trideuteriomethyl)-3-thia-11,16-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13(18),14,16-octaene |
| SMILES | [2H]C([2H])([2H])n1c2[n+](c3sc4ccccc4c31)Cc1cnccc1-2 |
| InChI | InChI=1S/C16H12N3S/c1-18-14-12-4-2-3-5-13(12)20-16(14)19-9-10-8-17-7-6-11(10)15(18)19/h2-8H,9H2,1H3/q+1/i1D3 |
| InChIKey | FMZDMQHHBWERLY-FIBGUPNXSA-N |
| XLogP | 3.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|