C13H17NO2 — CID 162021021
2-methyl-3-(oxolan-2-ylmethyl)-2H-1,3-benzoxazole (PubChem CID 162021021) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-methyl-3-(oxolan-2-ylmethyl)-2H-1,3-benzoxazole.
| Compound Name | 2-methyl-3-(oxolan-2-ylmethyl)-2H-1,3-benzoxazole |
|---|---|
| PubChem CID | 162021021 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-methyl-3-(oxolan-2-ylmethyl)-2H-1,3-benzoxazole |
| SMILES | CC1Oc2ccccc2N1CC1CCCO1 |
| InChI | InChI=1S/C13H17NO2/c1-10-14(9-11-5-4-8-15-11)12-6-2-3-7-13(12)16-10/h2-3,6-7,10-11H,4-5,8-9H2,1H3 |
| InChIKey | ZWVLJYDLAVENDI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |