C16H20N2O4S — CID 8655507
methyl (2R)-4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylate (PubChem CID 8655507) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl (2R)-4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylate.
| Compound Name | methyl (2R)-4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 8655507 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl (2R)-4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=S)NC[C@H]2CCCO2)c2ccccc2O1 |
| InChI | InChI=1S/C16H20N2O4S/c1-20-15(19)14-10-18(12-6-2-3-7-13(12)22-14)16(23)17-9-11-5-4-8-21-11/h2-3,6-7,11,14H,4-5,8-10H2,1H3,(H,17,23)/t11-,14-/m1/s1 |
| InChIKey | DYCARWAOHRSVAK-BXUZGUMPSA-N |
| XLogP | 1.48 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|