C15H22N3O3S+ — CID 8655481
2-[[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzoxazine-4-carbothioyl]amino]ethyl-dimethylazanium (PubChem CID 8655481) has the molecular formula C15H22N3O3S+ and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzoxazine-4-carbothioyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzoxazine-4-carbothioyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8655481 |
| Molecular Formula | C15H22N3O3S+ |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzoxazine-4-carbothioyl]amino]ethyl-dimethylazanium |
| SMILES | COC(=O)[C@H]1CN(C(=S)NCC[NH+](C)C)c2ccccc2O1 |
| InChI | InChI=1S/C15H21N3O3S/c1-17(2)9-8-16-15(22)18-10-13(14(19)20-3)21-12-7-5-4-6-11(12)18/h4-7,13H,8-10H2,1-3H3,(H,16,22)/p+1/t13-/m1/s1 |
| InChIKey | VOKWXILFUPLNNY-CYBMUJFWSA-O |
| XLogP | -0.55 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|