C14H17N3O2S — CID 8659578
3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2,4-dihydroquinoxaline-1-carbothioamide (PubChem CID 8659578) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2,4-dihydroquinoxaline-1-carbothioamide.
| Compound Name | 3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2,4-dihydroquinoxaline-1-carbothioamide |
|---|---|
| PubChem CID | 8659578 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-oxo-N-[[(2S)-oxolan-2-yl]methyl]-2,4-dihydroquinoxaline-1-carbothioamide |
| SMILES | O=C1CN(C(=S)NC[C@@H]2CCCO2)c2ccccc2N1 |
| InChI | InChI=1S/C14H17N3O2S/c18-13-9-17(12-6-2-1-5-11(12)16-13)14(20)15-8-10-4-3-7-19-10/h1-2,5-6,10H,3-4,7-9H2,(H,15,20)(H,16,18)/t10-/m0/s1 |
| InChIKey | FDKWFTSUTXDKHP-JTQLQIEISA-N |
| XLogP | 1.50 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|