C23H25N3O3S — CID 92732994
(6S)-7-oxo-N-[[(2R)-oxolan-2-yl]methyl]-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide (PubChem CID 92732994) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is (6S)-7-oxo-N-[[(2R)-oxolan-2-yl]methyl]-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide.
| Compound Name | (6S)-7-oxo-N-[[(2R)-oxolan-2-yl]methyl]-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 92732994 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (6S)-7-oxo-N-[[(2R)-oxolan-2-yl]methyl]-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide |
| SMILES | O=C1CCCC2=C1[C@@H](c1cccs1)N(C(=O)NC[C@H]1CCCO1)c1ccccc1N2 |
| InChI | InChI=1S/C23H25N3O3S/c27-19-10-3-8-17-21(19)22(20-11-5-13-30-20)26(18-9-2-1-7-16(18)25-17)23(28)24-14-15-6-4-12-29-15/h1-2,5,7,9,11,13,15,22,25H,3-4,6,8,10,12,14H2,(H,24,28)/t15-,22-/m1/s1 |
| InChIKey | AXVJVKKURUBIMN-IVZQSRNASA-N |
| XLogP | 4.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |