C25H27N3O4S — CID 46366991
1-morpholin-4-yl-4-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)butane-1,4-dione (PubChem CID 46366991) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 1-morpholin-4-yl-4-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)butane-1,4-dione.
| Compound Name | 1-morpholin-4-yl-4-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 46366991 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-morpholin-4-yl-4-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)butane-1,4-dione |
| SMILES | O=C1CCCC2=C1C(c1cccs1)N(C(=O)CCC(=O)N1CCOCC1)c1ccccc1N2 |
| InChI | InChI=1S/C25H27N3O4S/c29-20-8-3-6-18-24(20)25(21-9-4-16-33-21)28(19-7-2-1-5-17(19)26-18)23(31)11-10-22(30)27-12-14-32-15-13-27/h1-2,4-5,7,9,16,25-26H,3,6,8,10-15H2 |
| InChIKey | FGFQUQODHJEENU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |