C26H25N3O2S — CID 46366924
N-(3,5-dimethylphenyl)-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide (PubChem CID 46366924) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 46366924 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)N2c3ccccc3NC3=C(C(=O)CCC3)C2c2cccs2)c1 |
| InChI | InChI=1S/C26H25N3O2S/c1-16-13-17(2)15-18(14-16)27-26(31)29-21-9-4-3-7-19(21)28-20-8-5-10-22(30)24(20)25(29)23-11-6-12-32-23/h3-4,6-7,9,11-15,25,28H,5,8,10H2,1-2H3,(H,27,31) |
| InChIKey | TVHYJLMBXAXXSD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |