C33H46N4O3 — CID 162028017
(2S)-N-[(3S,6S,7R,9aS)-7-[2-(dimethylamino)ethyl]-3-(3,3-diphenylpropanoyl)-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)butanamide (PubChem CID 162028017) has the molecular formula C33H46N4O3 and a molecular weight of 546.76 g/mol. Its IUPAC name is (2S)-N-[(3S,6S,7R,9aS)-7-[2-(dimethylamino)ethyl]-3-(3,3-diphenylpropanoyl)-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)butanamide.
| Compound Name | (2S)-N-[(3S,6S,7R,9aS)-7-[2-(dimethylamino)ethyl]-3-(3,3-diphenylpropanoyl)-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 162028017 |
| Molecular Formula | C33H46N4O3 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (2S)-N-[(3S,6S,7R,9aS)-7-[2-(dimethylamino)ethyl]-3-(3,3-diphenylpropanoyl)-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)butanamide |
| SMILES | CC[C@H](NC)C(=O)N[C@@H]1C(=O)N2[C@@H](CC[C@@H]1CCN(C)C)CC[C@H]2C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H46N4O3/c1-5-28(34-2)32(39)35-31-25(20-21-36(3)4)16-17-26-18-19-29(37(26)33(31)40)30(38)22-27(23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,25-29,31,34H,5,16-22H2,1-4H3,(H,35,39)/t25-,26+,28+,29+,31+/m1/s1 |
| InChIKey | XAUBCSKRMWFINI-JFCMIOGGSA-N |
| XLogP | 3.98 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |