C17H23NO5 — CID 162030805
4-O-tert-butyl 1-O-[3-(2-methylidene-6-oxo-3H-pyridin-4-yl)propyl] (E)-but-2-enedioate (PubChem CID 162030805) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[3-(2-methylidene-6-oxo-3H-pyridin-4-yl)propyl] (E)-but-2-enedioate.
| Compound Name | 4-O-tert-butyl 1-O-[3-(2-methylidene-6-oxo-3H-pyridin-4-yl)propyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 162030805 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-O-tert-butyl 1-O-[3-(2-methylidene-6-oxo-3H-pyridin-4-yl)propyl] (E)-but-2-enedioate |
| SMILES | C=C1CC(CCCOC(=O)/C=C/C(=O)OC(C)(C)C)=CC(=O)N1 |
| InChI | InChI=1S/C17H23NO5/c1-12-10-13(11-14(19)18-12)6-5-9-22-15(20)7-8-16(21)23-17(2,3)4/h7-8,11H,1,5-6,9-10H2,2-4H3,(H,18,19)/b8-7+ |
| InChIKey | SXXUTMDNJHNIQR-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|