C16H22O5 — CID 147635035
4-O-[3-(5,5-dimethyl-3-oxocyclohexen-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 147635035) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-O-[3-(5,5-dimethyl-3-oxocyclohexen-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-(5,5-dimethyl-3-oxocyclohexen-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 147635035 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-O-[3-(5,5-dimethyl-3-oxocyclohexen-1-yl)propyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCCC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C16H22O5/c1-16(2)10-12(9-13(17)11-16)5-4-8-21-15(19)7-6-14(18)20-3/h6-7,9H,4-5,8,10-11H2,1-3H3/b7-6+ |
| InChIKey | GGLYJANDHIEJPH-VOTSOKGWSA-N |
| XLogP | 2.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|