C13H28O2 — CID 162034273
2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane (PubChem CID 162034273) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane.
| Compound Name | 2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane |
|---|---|
| PubChem CID | 162034273 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane |
| SMILES | CC(CC(C)(C)C)OCCOC(C)(C)C |
| InChI | InChI=1S/C13H28O2/c1-11(10-12(2,3)4)14-8-9-15-13(5,6)7/h11H,8-10H2,1-7H3 |
| InChIKey | VOIOBRARUIIKGT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|