C16H30O3 — CID 165380005
4,4-dimethyl-1-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propan-2-yloxy]pent-2-yne (PubChem CID 165380005) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 4,4-dimethyl-1-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propan-2-yloxy]pent-2-yne.
| Compound Name | 4,4-dimethyl-1-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propan-2-yloxy]pent-2-yne |
|---|---|
| PubChem CID | 165380005 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 4,4-dimethyl-1-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propan-2-yloxy]pent-2-yne |
| SMILES | CC(COCCOC(C)(C)C)OCC#CC(C)(C)C |
| InChI | InChI=1S/C16H30O3/c1-14(18-10-8-9-15(2,3)4)13-17-11-12-19-16(5,6)7/h14H,10-13H2,1-7H3 |
| InChIKey | AJKISXJKZMOCDS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|