About 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride
2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride (PubChem CID 162036346) has the molecular formula C17H15Cl2Zr
and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride.
Molecular Properties
| Compound Name | 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride |
| PubChem CID | 162036346 |
| Molecular Formula | C17H15Cl2Zr |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride |
| SMILES | Cc1cc2c(-c3ccccc3C)cccc2[cH-]1.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C17H15.2ClH.Zr/c1-12-10-14-7-5-9-16(17(14)11-12)15-8-4-3-6-13(15)2;;;/h3-11H,1-2H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | WOTMAGCFGFTCHM-UHFFFAOYSA-L |
| XLogP | -1.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride?
The IUPAC name of 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride (CID 162036346) is 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride.
What is the SMILES notation for 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride?
The canonical SMILES for 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride is Cc1cc2c(-c3ccccc3C)cccc2[cH-]1.[Cl-].[Cl-].[Zr+3].
What is the InChIKey of 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride?
The InChIKey is WOTMAGCFGFTCHM-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H15.2ClH.Zr/c1-12-10-14-7-5-9-16(17(14)11-12)15-8-4-3-6-13(15)2;;;/h3-11H,1-2H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride?
2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride has a molecular weight of 381.44 g/mol, XLogP of -1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(2-methylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride is sourced from PubChem (CID 162036346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).