About platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine
platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine (PubChem CID 162042599) has the molecular formula C21H14N4Pt
and a molecular weight of 517.45 g/mol. Its IUPAC name is platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine.
Molecular Properties
| Compound Name | platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine |
| PubChem CID | 162042599 |
| Molecular Formula | C21H14N4Pt |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine |
| SMILES | [Pt+2].[c-]1c(Cc2[c-]c(-c3ccncn3)ccc2)cccc1-c1ccncn1 |
| InChI | InChI=1S/C21H14N4.Pt/c1-3-16(12-18(5-1)20-7-9-22-14-24-20)11-17-4-2-6-19(13-17)21-8-10-23-15-25-21;/h1-10,14-15H,11H2;/q-2;+2 |
| InChIKey | CUUDTHWDFHHKQU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine?
The IUPAC name of platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine (CID 162042599) is platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine.
What is the SMILES notation for platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine?
The canonical SMILES for platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine is [Pt+2].[c-]1c(Cc2[c-]c(-c3ccncn3)ccc2)cccc1-c1ccncn1.
What is the InChIKey of platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine?
The InChIKey is CUUDTHWDFHHKQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N4.Pt/c1-3-16(12-18(5-1)20-7-9-22-14-24-20)11-17-4-2-6-19(13-17)21-8-10-23-15-25-21;/h1-10,14-15H,11H2;/q-2;+2.
What are the key properties of platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine?
platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine has a molecular weight of 517.45 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for platinum(2+);4-[3-[(3-pyrimidin-4-ylbenzene-2-id-1-yl)methyl]benzene-2-id-1-yl]pyrimidine is sourced from PubChem (CID 162042599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).