C18H24N2O4 — CID 162042790
methyl 3-[4-[8-(hydroxymethyl)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]phenyl]propanoate (PubChem CID 162042790) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 3-[4-[8-(hydroxymethyl)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[8-(hydroxymethyl)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 162042790 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl 3-[4-[8-(hydroxymethyl)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(N2CC3C(CO)CCCN3C2=O)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-24-17(22)9-6-13-4-7-15(8-5-13)20-11-16-14(12-21)3-2-10-19(16)18(20)23/h4-5,7-8,14,16,21H,2-3,6,9-12H2,1H3 |
| InChIKey | WWPWNZJNFLOKMK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |