About 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite
2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite (PubChem CID 162045826) has the molecular formula C20H31O5P
and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite.
Molecular Properties
| Compound Name | 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite |
| PubChem CID | 162045826 |
| Molecular Formula | C20H31O5P |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite |
| SMILES | C.CCOP(OCC)OCC.Oc1ccccc1C(O)c1ccccc1 |
| InChI | InChI=1S/C13H12O2.C6H15O3P.CH4/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;1-4-7-10(8-5-2)9-6-3;/h1-9,13-15H;4-6H2,1-3H3;1H4 |
| InChIKey | YXWIMTZUYMDXOY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite?
The IUPAC name of 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite (CID 162045826) is 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite.
What is the SMILES notation for 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite?
The canonical SMILES for 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite is C.CCOP(OCC)OCC.Oc1ccccc1C(O)c1ccccc1.
What is the InChIKey of 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite?
The InChIKey is YXWIMTZUYMDXOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2.C6H15O3P.CH4/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;1-4-7-10(8-5-2)9-6-3;/h1-9,13-15H;4-6H2,1-3H3;1H4.
What are the key properties of 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite?
2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite has a molecular weight of 382.44 g/mol, XLogP of 5.43, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[hydroxy(phenyl)methyl]phenol;methane;triethyl phosphite is sourced from PubChem (CID 162045826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).