About 1H-imidazole;morpholine;pyridine
1H-imidazole;morpholine;pyridine (PubChem CID 162047077) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 1H-imidazole;morpholine;pyridine.
Molecular Properties
| Compound Name | 1H-imidazole;morpholine;pyridine |
| PubChem CID | 162047077 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1H-imidazole;morpholine;pyridine |
| SMILES | C1COCCN1.c1c[nH]cn1.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4H9NO.C3H4N2/c1-2-4-6-5-3-1;1-3-6-4-2-5-1;1-2-5-3-4-1/h1-5H;5H,1-4H2;1-3H,(H,4,5) |
| InChIKey | YYAMTIXIGHATGA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-imidazole;morpholine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;morpholine;pyridine?
The IUPAC name of 1H-imidazole;morpholine;pyridine (CID 162047077) is 1H-imidazole;morpholine;pyridine.
What is the SMILES notation for 1H-imidazole;morpholine;pyridine?
The canonical SMILES for 1H-imidazole;morpholine;pyridine is C1COCCN1.c1c[nH]cn1.c1ccncc1.
What is the InChIKey of 1H-imidazole;morpholine;pyridine?
The InChIKey is YYAMTIXIGHATGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C4H9NO.C3H4N2/c1-2-4-6-5-3-1;1-3-6-4-2-5-1;1-2-5-3-4-1/h1-5H;5H,1-4H2;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;morpholine;pyridine?
1H-imidazole;morpholine;pyridine has a molecular weight of 234.30 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;morpholine;pyridine is sourced from PubChem (CID 162047077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).