About phenylphosphane;phthalic acid
phenylphosphane;phthalic acid (PubChem CID 162050556) has the molecular formula C22H19O8P
and a molecular weight of 442.36 g/mol. Its IUPAC name is phenylphosphane;phthalic acid.
Molecular Properties
| Compound Name | phenylphosphane;phthalic acid |
| PubChem CID | 162050556 |
| Molecular Formula | C22H19O8P |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | phenylphosphane;phthalic acid |
| SMILES | O=C(O)c1ccccc1C(=O)O.O=C(O)c1ccccc1C(=O)O.Pc1ccccc1 |
| InChI | InChI=1S/2C8H6O4.C6H7P/c2*9-7(10)5-3-1-2-4-6(5)8(11)12;7-6-4-2-1-3-5-6/h2*1-4H,(H,9,10)(H,11,12);1-5H,7H2 |
| InChIKey | YYMLKMKPDYKLGM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenylphosphane;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylphosphane;phthalic acid?
The IUPAC name of phenylphosphane;phthalic acid (CID 162050556) is phenylphosphane;phthalic acid.
What is the SMILES notation for phenylphosphane;phthalic acid?
The canonical SMILES for phenylphosphane;phthalic acid is O=C(O)c1ccccc1C(=O)O.O=C(O)c1ccccc1C(=O)O.Pc1ccccc1.
What is the InChIKey of phenylphosphane;phthalic acid?
The InChIKey is YYMLKMKPDYKLGM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6O4.C6H7P/c2*9-7(10)5-3-1-2-4-6(5)8(11)12;7-6-4-2-1-3-5-6/h2*1-4H,(H,9,10)(H,11,12);1-5H,7H2.
What are the key properties of phenylphosphane;phthalic acid?
phenylphosphane;phthalic acid has a molecular weight of 442.36 g/mol, XLogP of 3.35, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylphosphane;phthalic acid is sourced from PubChem (CID 162050556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).