C12H21N3 — CID 162052706
2,3,3a,4-tetrahydro-1H-indole;piperazine (PubChem CID 162052706) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-indole;piperazine.
| Compound Name | 2,3,3a,4-tetrahydro-1H-indole;piperazine |
|---|---|
| PubChem CID | 162052706 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-indole;piperazine |
| SMILES | C1=CCC2CCNC2=C1.C1CNCCN1 |
| InChI | InChI=1S/C8H11N.C4H10N2/c1-2-4-8-7(3-1)5-6-9-8;1-2-6-4-3-5-1/h1-2,4,7,9H,3,5-6H2;5-6H,1-4H2 |
| InChIKey | YYTIWIWGIDGIAR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |