C21H13F5N2O2 — CID 162054707
1-[4-[(E)-3-(1H-imidazol-2-yl)-3-oxoprop-1-enyl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one (PubChem CID 162054707) has the molecular formula C21H13F5N2O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 1-[4-[(E)-3-(1H-imidazol-2-yl)-3-oxoprop-1-enyl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one.
| Compound Name | 1-[4-[(E)-3-(1H-imidazol-2-yl)-3-oxoprop-1-enyl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 162054707 |
| Molecular Formula | C21H13F5N2O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1-[4-[(E)-3-(1H-imidazol-2-yl)-3-oxoprop-1-enyl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(/C=C/C(=O)c2ncc[nH]2)cc1)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H13F5N2O2/c22-16-14(17(23)19(25)20(26)18(16)24)10-13(29)9-12-3-1-11(2-4-12)5-6-15(30)21-27-7-8-28-21/h1-8H,9-10H2,(H,27,28)/b6-5+ |
| InChIKey | YZAFSBJQGPIGEE-AATRIKPKSA-N |
| XLogP | 4.36 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|