C19H24I2O3V — CID 162055260
diiodovanadium;2-(2,6-dimethylphenyl)acetic acid;(2,6-dimethylphenyl)methanol (PubChem CID 162055260) has the molecular formula C19H24I2O3V and a molecular weight of 605.15 g/mol. Its IUPAC name is diiodovanadium;2-(2,6-dimethylphenyl)acetic acid;(2,6-dimethylphenyl)methanol.
| Compound Name | diiodovanadium;2-(2,6-dimethylphenyl)acetic acid;(2,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 162055260 |
| Molecular Formula | C19H24I2O3V |
| Molecular Weight | 605.15 g/mol |
| Exact Mass | 604.93 |
| IUPAC Name | diiodovanadium;2-(2,6-dimethylphenyl)acetic acid;(2,6-dimethylphenyl)methanol |
| SMILES | Cc1cccc(C)c1CC(=O)O.Cc1cccc(C)c1CO.I[V]I |
| InChI | InChI=1S/C10H12O2.C9H12O.2HI.V/c1-7-4-3-5-8(2)9(7)6-10(11)12;1-7-4-3-5-8(2)9(7)6-10;;;/h3-5H,6H2,1-2H3,(H,11,12);3-5,10H,6H2,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | YZBYXHHXEQIJNV-UHFFFAOYSA-L |
| XLogP | 5.50 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.15 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|