C23H35Cl — CID 162057738
2-tert-butyl-1-chloro-3-methylbenzene;1-tert-butyl-2-methylbenzene;methane (PubChem CID 162057738) has the molecular formula C23H35Cl and a molecular weight of 346.99 g/mol. Its IUPAC name is 2-tert-butyl-1-chloro-3-methylbenzene;1-tert-butyl-2-methylbenzene;methane.
| Compound Name | 2-tert-butyl-1-chloro-3-methylbenzene;1-tert-butyl-2-methylbenzene;methane |
|---|---|
| PubChem CID | 162057738 |
| Molecular Formula | C23H35Cl |
| Molecular Weight | 346.99 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-tert-butyl-1-chloro-3-methylbenzene;1-tert-butyl-2-methylbenzene;methane |
| SMILES | C.Cc1cccc(Cl)c1C(C)(C)C.Cc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C11H15Cl.C11H16.CH4/c1-8-6-5-7-9(12)10(8)11(2,3)4;1-9-7-5-6-8-10(9)11(2,3)4;/h5-7H,1-4H3;5-8H,1-4H3;1H4 |
| InChIKey | YZKIBAPDDGNVBJ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.99 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |