About sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide
sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide (PubChem CID 162059409) has the molecular formula C7H15NaO6S2
and a molecular weight of 282.31 g/mol. Its IUPAC name is sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide.
Molecular Properties
| Compound Name | sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide |
| PubChem CID | 162059409 |
| Molecular Formula | C7H15NaO6S2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide |
| SMILES | CCCCS(=O)(=O)[O-].O=S1(=O)CCCO1.[Na+] |
| InChI | InChI=1S/C4H10O3S.C3H6O3S.Na/c1-2-3-4-8(5,6)7;4-7(5)3-1-2-6-7;/h2-4H2,1H3,(H,5,6,7);1-3H2;/q;;+1/p-1 |
| InChIKey | YZPYKSIPIFYVIB-UHFFFAOYSA-M |
| XLogP | -2.93 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide?
The IUPAC name of sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide (CID 162059409) is sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide.
What is the SMILES notation for sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide?
The canonical SMILES for sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide is CCCCS(=O)(=O)[O-].O=S1(=O)CCCO1.[Na+].
What is the InChIKey of sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide?
The InChIKey is YZPYKSIPIFYVIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O3S.C3H6O3S.Na/c1-2-3-4-8(5,6)7;4-7(5)3-1-2-6-7;/h2-4H2,1H3,(H,5,6,7);1-3H2;/q;;+1/p-1.
What are the key properties of sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide?
sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide has a molecular weight of 282.31 g/mol, XLogP of -2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;butane-1-sulfonate;oxathiolane 2,2-dioxide is sourced from PubChem (CID 162059409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).