C16H23Cl — CID 162059670
1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene (PubChem CID 162059670) has the molecular formula C16H23Cl and a molecular weight of 250.81 g/mol. Its IUPAC name is 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene.
| Compound Name | 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene |
|---|---|
| PubChem CID | 162059670 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene |
| SMILES | CC(C)(C)Cc1cc(C2CCCC2)ccc1Cl |
| InChI | InChI=1S/C16H23Cl/c1-16(2,3)11-14-10-13(8-9-15(14)17)12-6-4-5-7-12/h8-10,12H,4-7,11H2,1-3H3 |
| InChIKey | RVIWPVXJQDSQQB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |