About 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene
1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene (PubChem CID 162059670) has the molecular formula C16H23Cl
and a molecular weight of 250.81 g/mol. Its IUPAC name is 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene.
Molecular Properties
| Compound Name | 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene |
| PubChem CID | 162059670 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene |
| SMILES | CC(C)(C)Cc1cc(C2CCCC2)ccc1Cl |
| InChI | InChI=1S/C16H23Cl/c1-16(2,3)11-14-10-13(8-9-15(14)17)12-6-4-5-7-12/h8-10,12H,4-7,11H2,1-3H3 |
| InChIKey | RVIWPVXJQDSQQB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene?
The IUPAC name of 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene (CID 162059670) is 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene.
What is the SMILES notation for 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene?
The canonical SMILES for 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene is CC(C)(C)Cc1cc(C2CCCC2)ccc1Cl.
What is the InChIKey of 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene?
The InChIKey is RVIWPVXJQDSQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl/c1-16(2,3)11-14-10-13(8-9-15(14)17)12-6-4-5-7-12/h8-10,12H,4-7,11H2,1-3H3.
What are the key properties of 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene?
1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene has a molecular weight of 250.81 g/mol, XLogP of 5.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-cyclopentyl-2-(2,2-dimethylpropyl)benzene is sourced from PubChem (CID 162059670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).