About methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate
methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate (PubChem CID 162060004) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate.
Analyze methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
The IUPAC name of methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate (CID 162060004) is methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate.
What is the SMILES notation for methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
The canonical SMILES for methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate is COC(=O)c1ccc(-c2nnc(C(C)(C)C)o2)cc1C.
What is the InChIKey of methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
The InChIKey is BODNSGKLQXZWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-9-8-10(6-7-11(9)13(18)19-5)12-16-17-14(20-12)15(2,3)4/h6-8H,1-5H3.
What are the key properties of methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate has a molecular weight of 274.32 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate is sourced from PubChem (CID 162060004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).