methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate

C14H14N2O3 — CID 162060001

IUPACmethyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate
SMILESCOC(=O)c1ccc(-c2nnc(C3CC3)o2)cc1C
InChIInChI=1S/C14H14N2O3/c1-8-7-10(5-6-11(8)14(17)18-2)13-16-15-12(19-13)9-3-4-9/h5-7,9H,3-4H2,1-2H3
InChIKeyBFGWFKOWMHQEME-UHFFFAOYSA-N
MW258.28 g/mol
LogP2.71
Rot. Bonds3

About methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate

methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate (PubChem CID 162060001) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate.

Molecular Properties

Compound Namemethyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate
PubChem CID162060001
Molecular FormulaC14H14N2O3
Molecular Weight258.28 g/mol
Exact Mass258.10
IUPAC Namemethyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate
SMILESCOC(=O)c1ccc(-c2nnc(C3CC3)o2)cc1C
InChIInChI=1S/C14H14N2O3/c1-8-7-10(5-6-11(8)14(17)18-2)13-16-15-12(19-13)9-3-4-9/h5-7,9H,3-4H2,1-2H3
InChIKeyBFGWFKOWMHQEME-UHFFFAOYSA-N
XLogP2.71
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.28
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
The IUPAC name of methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate (CID 162060001) is methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate.
What is the SMILES notation for methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
The canonical SMILES for methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate is COC(=O)c1ccc(-c2nnc(C3CC3)o2)cc1C.
What is the InChIKey of methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
The InChIKey is BFGWFKOWMHQEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c1-8-7-10(5-6-11(8)14(17)18-2)13-16-15-12(19-13)9-3-4-9/h5-7,9H,3-4H2,1-2H3.
What are the key properties of methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate?
methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate has a molecular weight of 258.28 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylbenzoate is sourced from PubChem (CID 162060001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).