C39H42BN3 — CID 162061763
5-(2,6-dimethyl-4-pyrimidin-2-ylphenyl)-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine (PubChem CID 162061763) has the molecular formula C39H42BN3 and a molecular weight of 563.60 g/mol. Its IUPAC name is 5-(2,6-dimethyl-4-pyrimidin-2-ylphenyl)-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine.
| Compound Name | 5-(2,6-dimethyl-4-pyrimidin-2-ylphenyl)-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine |
|---|---|
| PubChem CID | 162061763 |
| Molecular Formula | C39H42BN3 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | 5-(2,6-dimethyl-4-pyrimidin-2-ylphenyl)-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine |
| SMILES | Cc1cc(-c2ncccn2)cc(C)c1N1c2ccccc2B(c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2ccccc21 |
| InChI | InChI=1S/C39H42BN3/c1-24(2)29-22-31(25(3)4)37(32(23-29)26(5)6)40-33-14-9-11-16-35(33)43(36-17-12-10-15-34(36)40)38-27(7)20-30(21-28(38)8)39-41-18-13-19-42-39/h9-26H,1-8H3 |
| InChIKey | RSNCLFKGSQHASJ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|