C67H71B2N — CID 140835399
10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-9,9-diphenylacridine (PubChem CID 140835399) has the molecular formula C67H71B2N and a molecular weight of 911.94 g/mol. Its IUPAC name is 10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-9,9-diphenylacridine.
| Compound Name | 10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-9,9-diphenylacridine |
|---|---|
| PubChem CID | 140835399 |
| Molecular Formula | C67H71B2N |
| Molecular Weight | 911.94 g/mol |
| Exact Mass | 911.58 |
| IUPAC Name | 10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-9,9-diphenylacridine |
| SMILES | CC(C)c1cc(C(C)C)c(B2c3ccccc3B(c3c(C(C)C)cc(C(C)C)cc3C(C)C)c3cc(N4c5ccccc5C(c5ccccc5)(c5ccccc5)c5ccccc54)ccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C67H71B2N/c1-42(2)48-37-53(44(5)6)65(54(38-48)45(7)8)68-59-31-21-22-32-60(59)69(66-55(46(9)10)39-49(43(3)4)40-56(66)47(11)12)62-41-52(35-36-61(62)68)70-63-33-23-19-29-57(63)67(50-25-15-13-16-26-50,51-27-17-14-18-28-51)58-30-20-24-34-64(58)70/h13-47H,1-12H3 |
| InChIKey | JOJHDFMERFNUHN-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.94 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|