C69H75B2NSi — CID 140835309
10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-5',5'-dimethylspiro[acridine-9,10'-benzo[b][1]benzosiline] (PubChem CID 140835309) has the molecular formula C69H75B2NSi and a molecular weight of 968.08 g/mol. Its IUPAC name is 10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-5',5'-dimethylspiro[acridine-9,10'-benzo[b][1]benzosiline].
| Compound Name | 10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-5',5'-dimethylspiro[acridine-9,10'-benzo[b][1]benzosiline] |
|---|---|
| PubChem CID | 140835309 |
| Molecular Formula | C69H75B2NSi |
| Molecular Weight | 968.08 g/mol |
| Exact Mass | 967.59 |
| IUPAC Name | 10-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]-5',5'-dimethylspiro[acridine-9,10'-benzo[b][1]benzosiline] |
| SMILES | CC(C)c1cc(C(C)C)c(B2c3ccccc3B(c3c(C(C)C)cc(C(C)C)cc3C(C)C)c3cc(N4c5ccccc5C5(c6ccccc64)c4ccccc4[Si](C)(C)c4ccccc45)ccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C69H75B2NSi/c1-42(2)48-37-51(44(5)6)67(52(38-48)45(7)8)70-59-29-19-20-30-60(59)71(68-53(46(9)10)39-49(43(3)4)40-54(68)47(11)12)62-41-50(35-36-61(62)70)72-63-31-21-15-25-55(63)69(56-26-16-22-32-64(56)72)57-27-17-23-33-65(57)73(13,14)66-34-24-18-28-58(66)69/h15-47H,1-14H3 |
| InChIKey | PDFOWLMQPRWSOY-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.08 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|