C73H73B2NS — CID 140835417
10-[3-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]spiro[acridine-9,9'-thioxanthene] (PubChem CID 140835417) has the molecular formula C73H73B2NS and a molecular weight of 1018.09 g/mol. Its IUPAC name is 10-[3-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]spiro[acridine-9,9'-thioxanthene].
| Compound Name | 10-[3-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]spiro[acridine-9,9'-thioxanthene] |
|---|---|
| PubChem CID | 140835417 |
| Molecular Formula | C73H73B2NS |
| Molecular Weight | 1018.09 g/mol |
| Exact Mass | 1017.56 |
| IUPAC Name | 10-[3-[5,10-bis[2,4,6-tri(propan-2-yl)phenyl]boranthren-2-yl]phenyl]spiro[acridine-9,9'-thioxanthene] |
| SMILES | CC(C)c1cc(C(C)C)c(B2c3ccccc3B(c3c(C(C)C)cc(C(C)C)cc3C(C)C)c3cc(-c4cccc(N5c6ccccc6C6(c7ccccc7Sc7ccccc76)c6ccccc65)c4)ccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C73H73B2NS/c1-44(2)52-39-55(46(5)6)71(56(40-52)47(7)8)74-63-30-17-18-31-64(63)75(72-57(48(9)10)41-53(45(3)4)42-58(72)49(11)12)66-43-51(36-37-65(66)74)50-24-23-25-54(38-50)76-67-32-19-13-26-59(67)73(60-27-14-20-33-68(60)76)61-28-15-21-34-69(61)77-70-35-22-16-29-62(70)73/h13-49H,1-12H3 |
| InChIKey | VOUVNIMRABQCCM-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.09 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|