C29H39FN4O5S2 — CID 162062232
2-cyclohexyl-8-[(E)-2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoroindol-4-yl]ethenyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;sulfane (PubChem CID 162062232) has the molecular formula C29H39FN4O5S2 and a molecular weight of 606.79 g/mol. Its IUPAC name is 2-cyclohexyl-8-[(E)-2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoroindol-4-yl]ethenyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;sulfane.
| Compound Name | 2-cyclohexyl-8-[(E)-2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoroindol-4-yl]ethenyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;sulfane |
|---|---|
| PubChem CID | 162062232 |
| Molecular Formula | C29H39FN4O5S2 |
| Molecular Weight | 606.79 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 2-cyclohexyl-8-[(E)-2-[1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoroindol-4-yl]ethenyl]sulfonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;sulfane |
| SMILES | CC1(C)OC[C@H](Cn2cc(F)c3c(/C=C/S(=O)(=O)N4CCC5(CC4)N=C(C4CCCCC4)NC5=O)cccc32)O1.S |
| InChI | InChI=1S/C29H37FN4O5S.H2S/c1-28(2)38-19-22(39-28)17-33-18-23(30)25-20(9-6-10-24(25)33)11-16-40(36,37)34-14-12-29(13-15-34)27(35)31-26(32-29)21-7-4-3-5-8-21;/h6,9-11,16,18,21-22H,3-5,7-8,12-15,17,19H2,1-2H3,(H,31,32,35);1H2/b16-11+;/t22-;/m0./s1 |
| InChIKey | YZZLQOCUIAFQOI-RLEZNZKFSA-N |
| XLogP | 4.29 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |