C17H15F2NO4 — CID 162063931
2,2-difluoro-2-phenylacetamide;methyl 2-oxo-2-phenylacetate (PubChem CID 162063931) has the molecular formula C17H15F2NO4 and a molecular weight of 335.31 g/mol. Its IUPAC name is 2,2-difluoro-2-phenylacetamide;methyl 2-oxo-2-phenylacetate.
| Compound Name | 2,2-difluoro-2-phenylacetamide;methyl 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 162063931 |
| Molecular Formula | C17H15F2NO4 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2,2-difluoro-2-phenylacetamide;methyl 2-oxo-2-phenylacetate |
| SMILES | COC(=O)C(=O)c1ccccc1.NC(=O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C9H8O3.C8H7F2NO/c1-12-9(11)8(10)7-5-3-2-4-6-7;9-8(10,7(11)12)6-4-2-1-3-5-6/h2-6H,1H3;1-5H,(H2,11,12) |
| InChIKey | ZAEZETGKEKCNSJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|