C18H15F3N2O4 — CID 161489087
benzamide;methyl 2-benzoylimino-3,3,3-trifluoropropanoate (PubChem CID 161489087) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is benzamide;methyl 2-benzoylimino-3,3,3-trifluoropropanoate.
| Compound Name | benzamide;methyl 2-benzoylimino-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 161489087 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | benzamide;methyl 2-benzoylimino-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)/C(=N\C(=O)c1ccccc1)C(F)(F)F.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H8F3NO3.C7H7NO/c1-18-10(17)8(11(12,13)14)15-9(16)7-5-3-2-4-6-7;8-7(9)6-4-2-1-3-5-6/h2-6H,1H3;1-5H,(H2,8,9)/b15-8+; |
| InChIKey | WFJGIPIOHRHBMO-TWNLEINFSA-N |
| XLogP | 2.79 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|