About sodium;propan-1-ol;sulfurothioic O-acid
sodium;propan-1-ol;sulfurothioic O-acid (PubChem CID 162066518) has the molecular formula C3H9NaO4S2
and a molecular weight of 196.22 g/mol. Its IUPAC name is sodium;propan-1-ol;sulfurothioic O-acid.
Molecular Properties
| Compound Name | sodium;propan-1-ol;sulfurothioic O-acid |
| PubChem CID | 162066518 |
| Molecular Formula | C3H9NaO4S2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | sodium;propan-1-ol;sulfurothioic O-acid |
| SMILES | O=S(O)(O)=S.[CH2-]CCO.[Na+] |
| InChI | InChI=1S/C3H7O.Na.H2O3S2/c1-2-3-4;;1-5(2,3)4/h4H,1-3H2;;(H2,1,2,3,4)/q-1;+1; |
| InChIKey | FUVDSMHKDJEOET-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;propan-1-ol;sulfurothioic O-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;propan-1-ol;sulfurothioic O-acid?
The IUPAC name of sodium;propan-1-ol;sulfurothioic O-acid (CID 162066518) is sodium;propan-1-ol;sulfurothioic O-acid.
What is the SMILES notation for sodium;propan-1-ol;sulfurothioic O-acid?
The canonical SMILES for sodium;propan-1-ol;sulfurothioic O-acid is O=S(O)(O)=S.[CH2-]CCO.[Na+].
What is the InChIKey of sodium;propan-1-ol;sulfurothioic O-acid?
The InChIKey is FUVDSMHKDJEOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O.Na.H2O3S2/c1-2-3-4;;1-5(2,3)4/h4H,1-3H2;;(H2,1,2,3,4)/q-1;+1;.
What are the key properties of sodium;propan-1-ol;sulfurothioic O-acid?
sodium;propan-1-ol;sulfurothioic O-acid has a molecular weight of 196.22 g/mol, XLogP of -3.11, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;propan-1-ol;sulfurothioic O-acid is sourced from PubChem (CID 162066518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).